C15H19ClN2O — CID 103603446
3-chloro-4-[2-(1-methylpiperidin-2-yl)ethoxy]benzonitrile (PubChem CID 103603446) has the molecular formula C15H19ClN2O and a molecular weight of 278.78 g/mol. Its IUPAC name is 3-chloro-4-[2-(1-methylpiperidin-2-yl)ethoxy]benzonitrile.
| Compound Name | 3-chloro-4-[2-(1-methylpiperidin-2-yl)ethoxy]benzonitrile |
|---|---|
| PubChem CID | 103603446 |
| Molecular Formula | C15H19ClN2O |
| Molecular Weight | 278.78 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 3-chloro-4-[2-(1-methylpiperidin-2-yl)ethoxy]benzonitrile |
| SMILES | CN1CCCCC1CCOc1ccc(C#N)cc1Cl |
| InChI | InChI=1S/C15H19ClN2O/c1-18-8-3-2-4-13(18)7-9-19-15-6-5-12(11-17)10-14(15)16/h5-6,10,13H,2-4,7-9H2,1H3 |
| InChIKey | YBPRLHXNQCIKAA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.78 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |