About 5-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]-5-oxopentanoic acid
5-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]-5-oxopentanoic acid (PubChem CID 103603976) has the molecular formula C10H15N3O4
and a molecular weight of 241.25 g/mol. Its IUPAC name is 5-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]-5-oxopentanoic acid.
Molecular Properties
| Compound Name | 5-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]-5-oxopentanoic acid |
| PubChem CID | 103603976 |
| Molecular Formula | C10H15N3O4 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 5-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]-5-oxopentanoic acid |
| SMILES | Cc1nc(CCNC(=O)CCCC(=O)O)no1 |
| InChI | InChI=1S/C10H15N3O4/c1-7-12-8(13-17-7)5-6-11-9(14)3-2-4-10(15)16/h2-6H2,1H3,(H,11,14)(H,15,16) |
| InChIKey | TYHXMHZGQDUWCY-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]-5-oxopentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]-5-oxopentanoic acid?
The IUPAC name of 5-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]-5-oxopentanoic acid (CID 103603976) is 5-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]-5-oxopentanoic acid.
What is the SMILES notation for 5-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]-5-oxopentanoic acid?
The canonical SMILES for 5-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]-5-oxopentanoic acid is Cc1nc(CCNC(=O)CCCC(=O)O)no1.
What is the InChIKey of 5-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]-5-oxopentanoic acid?
The InChIKey is TYHXMHZGQDUWCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O4/c1-7-12-8(13-17-7)5-6-11-9(14)3-2-4-10(15)16/h2-6H2,1H3,(H,11,14)(H,15,16).
What are the key properties of 5-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]-5-oxopentanoic acid?
5-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]-5-oxopentanoic acid has a molecular weight of 241.25 g/mol, XLogP of 0.29, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]-5-oxopentanoic acid is sourced from PubChem (CID 103603976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).