C12H16FNO4 — CID 103604552
2-fluoro-N,N-bis(2-hydroxyethyl)-4-methoxybenzamide (PubChem CID 103604552) has the molecular formula C12H16FNO4 and a molecular weight of 257.26 g/mol. Its IUPAC name is 2-fluoro-N,N-bis(2-hydroxyethyl)-4-methoxybenzamide.
| Compound Name | 2-fluoro-N,N-bis(2-hydroxyethyl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 103604552 |
| Molecular Formula | C12H16FNO4 |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 2-fluoro-N,N-bis(2-hydroxyethyl)-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)N(CCO)CCO)c(F)c1 |
| InChI | InChI=1S/C12H16FNO4/c1-18-9-2-3-10(11(13)8-9)12(17)14(4-6-15)5-7-16/h2-3,8,15-16H,4-7H2,1H3 |
| InChIKey | GDCAVXBZCMQHFD-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |