C13H25N — CID 103605044
2,3-dimethyl-N-(3-methylbut-2-enyl)cyclohexan-1-amine (PubChem CID 103605044) has the molecular formula C13H25N and a molecular weight of 195.35 g/mol. Its IUPAC name is 2,3-dimethyl-N-(3-methylbut-2-enyl)cyclohexan-1-amine.
| Compound Name | 2,3-dimethyl-N-(3-methylbut-2-enyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 103605044 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | 2,3-dimethyl-N-(3-methylbut-2-enyl)cyclohexan-1-amine |
| SMILES | CC(C)=CCNC1CCCC(C)C1C |
| InChI | InChI=1S/C13H25N/c1-10(2)8-9-14-13-7-5-6-11(3)12(13)4/h8,11-14H,5-7,9H2,1-4H3 |
| InChIKey | FCZGZNBJPMJGKL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|