C9H8ClF2NO — CID 103605147
N-(4-chloro-2-methylphenyl)-2,2-difluoroacetamide (PubChem CID 103605147) has the molecular formula C9H8ClF2NO and a molecular weight of 219.62 g/mol. Its IUPAC name is N-(4-chloro-2-methylphenyl)-2,2-difluoroacetamide.
| Compound Name | N-(4-chloro-2-methylphenyl)-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 103605147 |
| Molecular Formula | C9H8ClF2NO |
| Molecular Weight | 219.62 g/mol |
| Exact Mass | 219.03 |
| IUPAC Name | N-(4-chloro-2-methylphenyl)-2,2-difluoroacetamide |
| SMILES | Cc1cc(Cl)ccc1NC(=O)C(F)F |
| InChI | InChI=1S/C9H8ClF2NO/c1-5-4-6(10)2-3-7(5)13-9(14)8(11)12/h2-4,8H,1H3,(H,13,14) |
| InChIKey | PAJNEFVBUBYHQG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.62 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |