About dimethyl 3-(5-acetamidopentyl)-6,7-dihydro-5H-pyrrolizine-1,2-dicarboxylate
dimethyl 3-(5-acetamidopentyl)-6,7-dihydro-5H-pyrrolizine-1,2-dicarboxylate (PubChem CID 10360517) has the molecular formula C18H26N2O5
and a molecular weight of 350.42 g/mol. Its IUPAC name is dimethyl 3-(5-acetamidopentyl)-6,7-dihydro-5H-pyrrolizine-1,2-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 3-(5-acetamidopentyl)-6,7-dihydro-5H-pyrrolizine-1,2-dicarboxylate |
| PubChem CID | 10360517 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | dimethyl 3-(5-acetamidopentyl)-6,7-dihydro-5H-pyrrolizine-1,2-dicarboxylate |
| SMILES | COC(=O)c1c(C(=O)OC)c2n(c1CCCCCNC(C)=O)CCC2 |
| InChI | InChI=1S/C18H26N2O5/c1-12(21)19-10-6-4-5-8-13-15(17(22)24-2)16(18(23)25-3)14-9-7-11-20(13)14/h4-11H2,1-3H3,(H,19,21) |
| InChIKey | RIBDOZVFRZTTOA-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 3-(5-acetamidopentyl)-6,7-dihydro-5H-pyrrolizine-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 3-(5-acetamidopentyl)-6,7-dihydro-5H-pyrrolizine-1,2-dicarboxylate?
The IUPAC name of dimethyl 3-(5-acetamidopentyl)-6,7-dihydro-5H-pyrrolizine-1,2-dicarboxylate (CID 10360517) is dimethyl 3-(5-acetamidopentyl)-6,7-dihydro-5H-pyrrolizine-1,2-dicarboxylate.
What is the SMILES notation for dimethyl 3-(5-acetamidopentyl)-6,7-dihydro-5H-pyrrolizine-1,2-dicarboxylate?
The canonical SMILES for dimethyl 3-(5-acetamidopentyl)-6,7-dihydro-5H-pyrrolizine-1,2-dicarboxylate is COC(=O)c1c(C(=O)OC)c2n(c1CCCCCNC(C)=O)CCC2.
What is the InChIKey of dimethyl 3-(5-acetamidopentyl)-6,7-dihydro-5H-pyrrolizine-1,2-dicarboxylate?
The InChIKey is RIBDOZVFRZTTOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N2O5/c1-12(21)19-10-6-4-5-8-13-15(17(22)24-2)16(18(23)25-3)14-9-7-11-20(13)14/h4-11H2,1-3H3,(H,19,21).
What are the key properties of dimethyl 3-(5-acetamidopentyl)-6,7-dihydro-5H-pyrrolizine-1,2-dicarboxylate?
dimethyl 3-(5-acetamidopentyl)-6,7-dihydro-5H-pyrrolizine-1,2-dicarboxylate has a molecular weight of 350.42 g/mol, XLogP of 1.86, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 3-(5-acetamidopentyl)-6,7-dihydro-5H-pyrrolizine-1,2-dicarboxylate is sourced from PubChem (CID 10360517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).