C9H10FNO3 — CID 103606176
2-fluoro-N,4-dimethoxybenzamide (PubChem CID 103606176) has the molecular formula C9H10FNO3 and a molecular weight of 199.18 g/mol. Its IUPAC name is 2-fluoro-N,4-dimethoxybenzamide.
| Compound Name | 2-fluoro-N,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 103606176 |
| Molecular Formula | C9H10FNO3 |
| Molecular Weight | 199.18 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 2-fluoro-N,4-dimethoxybenzamide |
| SMILES | CONC(=O)c1ccc(OC)cc1F |
| InChI | InChI=1S/C9H10FNO3/c1-13-6-3-4-7(8(10)5-6)9(12)11-14-2/h3-5H,1-2H3,(H,11,12) |
| InChIKey | DMJBCWONVRBBOT-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.18 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|