C13H10Cl3N3O — CID 103606462
3,6-dichloro-N-[1-(2-chlorophenyl)ethyl]pyridazine-4-carboxamide (PubChem CID 103606462) has the molecular formula C13H10Cl3N3O and a molecular weight of 330.60 g/mol. Its IUPAC name is 3,6-dichloro-N-[1-(2-chlorophenyl)ethyl]pyridazine-4-carboxamide.
| Compound Name | 3,6-dichloro-N-[1-(2-chlorophenyl)ethyl]pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 103606462 |
| Molecular Formula | C13H10Cl3N3O |
| Molecular Weight | 330.60 g/mol |
| Exact Mass | 328.99 |
| IUPAC Name | 3,6-dichloro-N-[1-(2-chlorophenyl)ethyl]pyridazine-4-carboxamide |
| SMILES | CC(NC(=O)c1cc(Cl)nnc1Cl)c1ccccc1Cl |
| InChI | InChI=1S/C13H10Cl3N3O/c1-7(8-4-2-3-5-10(8)14)17-13(20)9-6-11(15)18-19-12(9)16/h2-7H,1H3,(H,17,20) |
| InChIKey | NHZBTFLYCRAHFR-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.60 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |