C20H20N2O4 — CID 10360654
10,11,12,17-tetramethoxy-3,4-diazatetracyclo[12.4.0.02,6.08,13]octadeca-1(14),2(6),4,8,10,12,15,17-octaene (PubChem CID 10360654) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is 10,11,12,17-tetramethoxy-3,4-diazatetracyclo[12.4.0.02,6.08,13]octadeca-1(14),2(6),4,8,10,12,15,17-octaene.
| Compound Name | 10,11,12,17-tetramethoxy-3,4-diazatetracyclo[12.4.0.02,6.08,13]octadeca-1(14),2(6),4,8,10,12,15,17-octaene |
|---|---|
| PubChem CID | 10360654 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 10,11,12,17-tetramethoxy-3,4-diazatetracyclo[12.4.0.02,6.08,13]octadeca-1(14),2(6),4,8,10,12,15,17-octaene |
| SMILES | COc1ccc2c(c1)-c1[nH]ncc1Cc1cc(OC)c(OC)c(OC)c1-2 |
| InChI | InChI=1S/C20H20N2O4/c1-23-13-5-6-14-15(9-13)18-12(10-21-22-18)7-11-8-16(24-2)19(25-3)20(26-4)17(11)14/h5-6,8-10H,7H2,1-4H3,(H,21,22) |
| InChIKey | DRFWXNYWSRNPKY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 65.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |