C10H11ClN2O3 — CID 103606885
5-chloro-N-[2-(cyclopropylamino)-2-oxoethyl]furan-2-carboxamide (PubChem CID 103606885) has the molecular formula C10H11ClN2O3 and a molecular weight of 242.66 g/mol. Its IUPAC name is 5-chloro-N-[2-(cyclopropylamino)-2-oxoethyl]furan-2-carboxamide.
| Compound Name | 5-chloro-N-[2-(cyclopropylamino)-2-oxoethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 103606885 |
| Molecular Formula | C10H11ClN2O3 |
| Molecular Weight | 242.66 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 5-chloro-N-[2-(cyclopropylamino)-2-oxoethyl]furan-2-carboxamide |
| SMILES | O=C(CNC(=O)c1ccc(Cl)o1)NC1CC1 |
| InChI | InChI=1S/C10H11ClN2O3/c11-8-4-3-7(16-8)10(15)12-5-9(14)13-6-1-2-6/h3-4,6H,1-2,5H2,(H,12,15)(H,13,14) |
| InChIKey | ZLAFHAICOCVRPO-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.66 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |