C13H15F4NO4S — CID 10360956
[4-[(4-fluorophenyl)methyl]morpholin-2-yl]methyl trifluoromethanesulfonate (PubChem CID 10360956) has the molecular formula C13H15F4NO4S and a molecular weight of 357.33 g/mol. Its IUPAC name is [4-[(4-fluorophenyl)methyl]morpholin-2-yl]methyl trifluoromethanesulfonate.
| Compound Name | [4-[(4-fluorophenyl)methyl]morpholin-2-yl]methyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10360956 |
| Molecular Formula | C13H15F4NO4S |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | [4-[(4-fluorophenyl)methyl]morpholin-2-yl]methyl trifluoromethanesulfonate |
| SMILES | O=S(=O)(OCC1CN(Cc2ccc(F)cc2)CCO1)C(F)(F)F |
| InChI | InChI=1S/C13H15F4NO4S/c14-11-3-1-10(2-4-11)7-18-5-6-21-12(8-18)9-22-23(19,20)13(15,16)17/h1-4,12H,5-9H2 |
| InChIKey | PIZQLIIZVWJPRS-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|