C22H28FNO2 — CID 10360989
(2E,4E,6E)-6-fluoro-3-methyl-7-(1-propan-2-yl-3,4-dihydro-2H-quinolin-6-yl)nona-2,4,6-trienoic acid (PubChem CID 10360989) has the molecular formula C22H28FNO2 and a molecular weight of 357.47 g/mol. Its IUPAC name is (2E,4E,6E)-6-fluoro-3-methyl-7-(1-propan-2-yl-3,4-dihydro-2H-quinolin-6-yl)nona-2,4,6-trienoic acid.
| Compound Name | (2E,4E,6E)-6-fluoro-3-methyl-7-(1-propan-2-yl-3,4-dihydro-2H-quinolin-6-yl)nona-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 10360989 |
| Molecular Formula | C22H28FNO2 |
| Molecular Weight | 357.47 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | (2E,4E,6E)-6-fluoro-3-methyl-7-(1-propan-2-yl-3,4-dihydro-2H-quinolin-6-yl)nona-2,4,6-trienoic acid |
| SMILES | CC/C(=C(F)/C=C/C(C)=C/C(=O)O)c1ccc2c(c1)CCCN2C(C)C |
| InChI | InChI=1S/C22H28FNO2/c1-5-19(20(23)10-8-16(4)13-22(25)26)17-9-11-21-18(14-17)7-6-12-24(21)15(2)3/h8-11,13-15H,5-7,12H2,1-4H3,(H,25,26)/b10-8+,16-13+,20-19+ |
| InChIKey | JKDCFKHUINGQAP-XLGPOJBNSA-N |
| XLogP | 5.53 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.47 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|