C21H29NO4 — CID 10361113
[3-[(3,5-dimethoxy-4-pentoxyphenyl)methylamino]phenyl]methanol (PubChem CID 10361113) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is [3-[(3,5-dimethoxy-4-pentoxyphenyl)methylamino]phenyl]methanol.
| Compound Name | [3-[(3,5-dimethoxy-4-pentoxyphenyl)methylamino]phenyl]methanol |
|---|---|
| PubChem CID | 10361113 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | [3-[(3,5-dimethoxy-4-pentoxyphenyl)methylamino]phenyl]methanol |
| SMILES | CCCCCOc1c(OC)cc(CNc2cccc(CO)c2)cc1OC |
| InChI | InChI=1S/C21H29NO4/c1-4-5-6-10-26-21-19(24-2)12-17(13-20(21)25-3)14-22-18-9-7-8-16(11-18)15-23/h7-9,11-13,22-23H,4-6,10,14-15H2,1-3H3 |
| InChIKey | YEAORWZTMQMJIS-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|