C18H25ClN4O2 — CID 10361449
4-N-(7-chloro-3-nitroquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine (PubChem CID 10361449) has the molecular formula C18H25ClN4O2 and a molecular weight of 364.88 g/mol. Its IUPAC name is 4-N-(7-chloro-3-nitroquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine.
| Compound Name | 4-N-(7-chloro-3-nitroquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine |
|---|---|
| PubChem CID | 10361449 |
| Molecular Formula | C18H25ClN4O2 |
| Molecular Weight | 364.88 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 4-N-(7-chloro-3-nitroquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine |
| SMILES | CCN(CC)CCCC(C)Nc1c([N+](=O)[O-])cnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C18H25ClN4O2/c1-4-22(5-2)10-6-7-13(3)21-18-15-9-8-14(19)11-16(15)20-12-17(18)23(24)25/h8-9,11-13H,4-7,10H2,1-3H3,(H,20,21) |
| InChIKey | VUUJVASZOJJHEP-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.88 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|