C13H14FIN2O2 — CID 103617048
1-(4-fluoro-2-iodobenzoyl)piperidine-3-carboxamide (PubChem CID 103617048) has the molecular formula C13H14FIN2O2 and a molecular weight of 376.17 g/mol. Its IUPAC name is 1-(4-fluoro-2-iodobenzoyl)piperidine-3-carboxamide.
| Compound Name | 1-(4-fluoro-2-iodobenzoyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 103617048 |
| Molecular Formula | C13H14FIN2O2 |
| Molecular Weight | 376.17 g/mol |
| Exact Mass | 376.01 |
| IUPAC Name | 1-(4-fluoro-2-iodobenzoyl)piperidine-3-carboxamide |
| SMILES | NC(=O)C1CCCN(C(=O)c2ccc(F)cc2I)C1 |
| InChI | InChI=1S/C13H14FIN2O2/c14-9-3-4-10(11(15)6-9)13(19)17-5-1-2-8(7-17)12(16)18/h3-4,6,8H,1-2,5,7H2,(H2,16,18) |
| InChIKey | YIZVQKIEELIQCB-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.17 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|