C22H25ClN2O — CID 10361712
(Z,4R,5S)-4-(4-chlorophenyl)-N-(3-phenylpropoxy)-1-azabicyclo[3.2.1]octan-6-imine (PubChem CID 10361712) has the molecular formula C22H25ClN2O and a molecular weight of 368.91 g/mol. Its IUPAC name is (Z,4R,5S)-4-(4-chlorophenyl)-N-(3-phenylpropoxy)-1-azabicyclo[3.2.1]octan-6-imine.
| Compound Name | (Z,4R,5S)-4-(4-chlorophenyl)-N-(3-phenylpropoxy)-1-azabicyclo[3.2.1]octan-6-imine |
|---|---|
| PubChem CID | 10361712 |
| Molecular Formula | C22H25ClN2O |
| Molecular Weight | 368.91 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | (Z,4R,5S)-4-(4-chlorophenyl)-N-(3-phenylpropoxy)-1-azabicyclo[3.2.1]octan-6-imine |
| SMILES | Clc1ccc([C@@H]2CCN3C/C(=N\OCCCc4ccccc4)[C@@H]2C3)cc1 |
| InChI | InChI=1S/C22H25ClN2O/c23-19-10-8-18(9-11-19)20-12-13-25-15-21(20)22(16-25)24-26-14-4-7-17-5-2-1-3-6-17/h1-3,5-6,8-11,20-21H,4,7,12-16H2/b24-22+/t20-,21+/m0/s1 |
| InChIKey | YKJNEMITUKMLRM-KSOTXXDYSA-N |
| XLogP | 4.76 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.91 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|