C16H31N3O3 — CID 103618127
tert-butyl 4-(2-morpholin-4-ylethylamino)piperidine-1-carboxylate (PubChem CID 103618127) has the molecular formula C16H31N3O3 and a molecular weight of 313.44 g/mol. Its IUPAC name is tert-butyl 4-(2-morpholin-4-ylethylamino)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(2-morpholin-4-ylethylamino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 103618127 |
| Molecular Formula | C16H31N3O3 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | tert-butyl 4-(2-morpholin-4-ylethylamino)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NCCN2CCOCC2)CC1 |
| InChI | InChI=1S/C16H31N3O3/c1-16(2,3)22-15(20)19-7-4-14(5-8-19)17-6-9-18-10-12-21-13-11-18/h14,17H,4-13H2,1-3H3 |
| InChIKey | CCOSJOFIRFVYTP-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |