C22H27ClN2O — CID 10361836
5-[2-(3-chlorophenyl)ethylamino]-1-(3-methylbut-2-enyl)-5,6,7,8-tetrahydroquinolin-2-one (PubChem CID 10361836) has the molecular formula C22H27ClN2O and a molecular weight of 370.92 g/mol. Its IUPAC name is 5-[2-(3-chlorophenyl)ethylamino]-1-(3-methylbut-2-enyl)-5,6,7,8-tetrahydroquinolin-2-one.
| Compound Name | 5-[2-(3-chlorophenyl)ethylamino]-1-(3-methylbut-2-enyl)-5,6,7,8-tetrahydroquinolin-2-one |
|---|---|
| PubChem CID | 10361836 |
| Molecular Formula | C22H27ClN2O |
| Molecular Weight | 370.92 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 5-[2-(3-chlorophenyl)ethylamino]-1-(3-methylbut-2-enyl)-5,6,7,8-tetrahydroquinolin-2-one |
| SMILES | CC(C)=CCn1c2c(ccc1=O)C(NCCc1cccc(Cl)c1)CCC2 |
| InChI | InChI=1S/C22H27ClN2O/c1-16(2)12-14-25-21-8-4-7-20(19(21)9-10-22(25)26)24-13-11-17-5-3-6-18(23)15-17/h3,5-6,9-10,12,15,20,24H,4,7-8,11,13-14H2,1-2H3 |
| InChIKey | GDVFHFMHDFUEFD-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.92 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|