C17H26NO6P — CID 10361851
[(2S,3aS,6aS)-2-(methoxymethyl)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-yl]methyl 2-pyridin-1-ium-1-ylethyl phosphate (PubChem CID 10361851) has the molecular formula C17H26NO6P and a molecular weight of 371.37 g/mol. Its IUPAC name is [(2S,3aS,6aS)-2-(methoxymethyl)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-yl]methyl 2-pyridin-1-ium-1-ylethyl phosphate.
| Compound Name | [(2S,3aS,6aS)-2-(methoxymethyl)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-yl]methyl 2-pyridin-1-ium-1-ylethyl phosphate |
|---|---|
| PubChem CID | 10361851 |
| Molecular Formula | C17H26NO6P |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | [(2S,3aS,6aS)-2-(methoxymethyl)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-yl]methyl 2-pyridin-1-ium-1-ylethyl phosphate |
| SMILES | COC[C@@H]1C[C@]2(COP(=O)([O-])OCC[n+]3ccccc3)CCC[C@@H]2O1 |
| InChI | InChI=1S/C17H26NO6P/c1-21-13-15-12-17(7-5-6-16(17)24-15)14-23-25(19,20)22-11-10-18-8-3-2-4-9-18/h2-4,8-9,15-16H,5-7,10-14H2,1H3/t15-,16-,17-/m0/s1 |
| InChIKey | FDGPRHKEAWXYLM-ULQDDVLXSA-N |
| XLogP | 1.45 |
| TPSA | 80.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|