C14H13Br2NO — CID 103619387
2,6-dibromo-4-[(3-methylanilino)methyl]phenol (PubChem CID 103619387) has the molecular formula C14H13Br2NO and a molecular weight of 371.07 g/mol. Its IUPAC name is 2,6-dibromo-4-[(3-methylanilino)methyl]phenol.
| Compound Name | 2,6-dibromo-4-[(3-methylanilino)methyl]phenol |
|---|---|
| PubChem CID | 103619387 |
| Molecular Formula | C14H13Br2NO |
| Molecular Weight | 371.07 g/mol |
| Exact Mass | 368.94 |
| IUPAC Name | 2,6-dibromo-4-[(3-methylanilino)methyl]phenol |
| SMILES | Cc1cccc(NCc2cc(Br)c(O)c(Br)c2)c1 |
| InChI | InChI=1S/C14H13Br2NO/c1-9-3-2-4-11(5-9)17-8-10-6-12(15)14(18)13(16)7-10/h2-7,17-18H,8H2,1H3 |
| InChIKey | DJQSZFGJYCTFCT-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.07 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |