About methyl 3-[dimethyl(phenyl)silyl]-2,3-diphenylpropanoate
methyl 3-[dimethyl(phenyl)silyl]-2,3-diphenylpropanoate (PubChem CID 10362075) has the molecular formula C24H26O2Si
and a molecular weight of 374.56 g/mol. Its IUPAC name is methyl 3-[dimethyl(phenyl)silyl]-2,3-diphenylpropanoate.
Molecular Properties
| Compound Name | methyl 3-[dimethyl(phenyl)silyl]-2,3-diphenylpropanoate |
| PubChem CID | 10362075 |
| Molecular Formula | C24H26O2Si |
| Molecular Weight | 374.56 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | methyl 3-[dimethyl(phenyl)silyl]-2,3-diphenylpropanoate |
| SMILES | COC(=O)C(c1ccccc1)C(c1ccccc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C24H26O2Si/c1-26-24(25)22(19-13-7-4-8-14-19)23(20-15-9-5-10-16-20)27(2,3)21-17-11-6-12-18-21/h4-18,22-23H,1-3H3 |
| InChIKey | GEYASECMWCAQCT-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.56 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[dimethyl(phenyl)silyl]-2,3-diphenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[dimethyl(phenyl)silyl]-2,3-diphenylpropanoate?
The IUPAC name of methyl 3-[dimethyl(phenyl)silyl]-2,3-diphenylpropanoate (CID 10362075) is methyl 3-[dimethyl(phenyl)silyl]-2,3-diphenylpropanoate.
What is the SMILES notation for methyl 3-[dimethyl(phenyl)silyl]-2,3-diphenylpropanoate?
The canonical SMILES for methyl 3-[dimethyl(phenyl)silyl]-2,3-diphenylpropanoate is COC(=O)C(c1ccccc1)C(c1ccccc1)[Si](C)(C)c1ccccc1.
What is the InChIKey of methyl 3-[dimethyl(phenyl)silyl]-2,3-diphenylpropanoate?
The InChIKey is GEYASECMWCAQCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26O2Si/c1-26-24(25)22(19-13-7-4-8-14-19)23(20-15-9-5-10-16-20)27(2,3)21-17-11-6-12-18-21/h4-18,22-23H,1-3H3.
What are the key properties of methyl 3-[dimethyl(phenyl)silyl]-2,3-diphenylpropanoate?
methyl 3-[dimethyl(phenyl)silyl]-2,3-diphenylpropanoate has a molecular weight of 374.56 g/mol, XLogP of 4.88, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[dimethyl(phenyl)silyl]-2,3-diphenylpropanoate is sourced from PubChem (CID 10362075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).