C24H40O3 — CID 10362198
5-(4,8,12-trimethyltridecyl)-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione (PubChem CID 10362198) has the molecular formula C24H40O3 and a molecular weight of 376.58 g/mol. Its IUPAC name is 5-(4,8,12-trimethyltridecyl)-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione.
| Compound Name | 5-(4,8,12-trimethyltridecyl)-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 10362198 |
| Molecular Formula | C24H40O3 |
| Molecular Weight | 376.58 g/mol |
| Exact Mass | 376.30 |
| IUPAC Name | 5-(4,8,12-trimethyltridecyl)-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC1=CCC2C(=O)OC(=O)C2C1 |
| InChI | InChI=1S/C24H40O3/c1-17(2)8-5-9-18(3)10-6-11-19(4)12-7-13-20-14-15-21-22(16-20)24(26)27-23(21)25/h14,17-19,21-22H,5-13,15-16H2,1-4H3 |
| InChIKey | UJZSKNNWYHCFEO-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.58 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|