C17H13F6NO2 — CID 10362210
N-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)naphthalen-1-yl]cyclopropanecarboxamide (PubChem CID 10362210) has the molecular formula C17H13F6NO2 and a molecular weight of 377.28 g/mol. Its IUPAC name is N-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)naphthalen-1-yl]cyclopropanecarboxamide.
| Compound Name | N-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)naphthalen-1-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 10362210 |
| Molecular Formula | C17H13F6NO2 |
| Molecular Weight | 377.28 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | N-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)naphthalen-1-yl]cyclopropanecarboxamide |
| SMILES | O=C(Nc1c(C(O)(C(F)(F)F)C(F)(F)F)ccc2ccccc12)C1CC1 |
| InChI | InChI=1S/C17H13F6NO2/c18-16(19,20)15(26,17(21,22)23)12-8-7-9-3-1-2-4-11(9)13(12)24-14(25)10-5-6-10/h1-4,7-8,10,26H,5-6H2,(H,24,25) |
| InChIKey | KCAQQXULGXEZEX-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.28 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |