C21H23N3O4 — CID 10362432
3-(7,8-dimethoxy-2-oxo-1-propyl-3H-1,4-benzodiazepin-5-yl)benzamide (PubChem CID 10362432) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is 3-(7,8-dimethoxy-2-oxo-1-propyl-3H-1,4-benzodiazepin-5-yl)benzamide.
| Compound Name | 3-(7,8-dimethoxy-2-oxo-1-propyl-3H-1,4-benzodiazepin-5-yl)benzamide |
|---|---|
| PubChem CID | 10362432 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 3-(7,8-dimethoxy-2-oxo-1-propyl-3H-1,4-benzodiazepin-5-yl)benzamide |
| SMILES | CCCN1C(=O)CN=C(c2cccc(C(N)=O)c2)c2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C21H23N3O4/c1-4-8-24-16-11-18(28-3)17(27-2)10-15(16)20(23-12-19(24)25)13-6-5-7-14(9-13)21(22)26/h5-7,9-11H,4,8,12H2,1-3H3,(H2,22,26) |
| InChIKey | QCMIUAFQXYEYIE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |