C24H32O4 — CID 10362613
(2E,4E)-3-methyl-5-[2-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-1,3-dioxolan-2-yl]penta-2,4-dienoic acid (PubChem CID 10362613) has the molecular formula C24H32O4 and a molecular weight of 384.52 g/mol. Its IUPAC name is (2E,4E)-3-methyl-5-[2-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-1,3-dioxolan-2-yl]penta-2,4-dienoic acid.
| Compound Name | (2E,4E)-3-methyl-5-[2-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-1,3-dioxolan-2-yl]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 10362613 |
| Molecular Formula | C24H32O4 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | (2E,4E)-3-methyl-5-[2-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-1,3-dioxolan-2-yl]penta-2,4-dienoic acid |
| SMILES | CC(/C=C/C1(c2cc3c(cc2C)C(C)(C)CCC3(C)C)OCCO1)=C\C(=O)O |
| InChI | InChI=1S/C24H32O4/c1-16(13-21(25)26)7-8-24(27-11-12-28-24)18-15-20-19(14-17(18)2)22(3,4)9-10-23(20,5)6/h7-8,13-15H,9-12H2,1-6H3,(H,25,26)/b8-7+,16-13+ |
| InChIKey | HAFGXEJYVGRDJJ-YWRSBGDESA-N |
| XLogP | 5.13 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|