C24H32O4 — CID 10362614
2-hydroxy-2-[(2E,6E)-8-hydroxy-3,7,11-trimethyldodeca-2,6,10-trienyl]-4-methyl-1-benzofuran-3-one (PubChem CID 10362614) has the molecular formula C24H32O4 and a molecular weight of 384.52 g/mol. Its IUPAC name is 2-hydroxy-2-[(2E,6E)-8-hydroxy-3,7,11-trimethyldodeca-2,6,10-trienyl]-4-methyl-1-benzofuran-3-one.
| Compound Name | 2-hydroxy-2-[(2E,6E)-8-hydroxy-3,7,11-trimethyldodeca-2,6,10-trienyl]-4-methyl-1-benzofuran-3-one |
|---|---|
| PubChem CID | 10362614 |
| Molecular Formula | C24H32O4 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | 2-hydroxy-2-[(2E,6E)-8-hydroxy-3,7,11-trimethyldodeca-2,6,10-trienyl]-4-methyl-1-benzofuran-3-one |
| SMILES | CC(C)=CCC(O)/C(C)=C/CC/C(C)=C/CC1(O)Oc2cccc(C)c2C1=O |
| InChI | InChI=1S/C24H32O4/c1-16(2)12-13-20(25)18(4)9-6-8-17(3)14-15-24(27)23(26)22-19(5)10-7-11-21(22)28-24/h7,9-12,14,20,25,27H,6,8,13,15H2,1-5H3/b17-14+,18-9+ |
| InChIKey | KAPQAECQDBIIBY-MQRUAEGHSA-N |
| XLogP | 5.04 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|