C20H13N5O2S — CID 10362759
N-methyl-4-oxo-1-[3-[2-(1,2,5-thiadiazol-3-yl)ethynyl]phenyl]-1,8-naphthyridine-3-carboxamide (PubChem CID 10362759) has the molecular formula C20H13N5O2S and a molecular weight of 387.42 g/mol. Its IUPAC name is N-methyl-4-oxo-1-[3-[2-(1,2,5-thiadiazol-3-yl)ethynyl]phenyl]-1,8-naphthyridine-3-carboxamide.
| Compound Name | N-methyl-4-oxo-1-[3-[2-(1,2,5-thiadiazol-3-yl)ethynyl]phenyl]-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 10362759 |
| Molecular Formula | C20H13N5O2S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | N-methyl-4-oxo-1-[3-[2-(1,2,5-thiadiazol-3-yl)ethynyl]phenyl]-1,8-naphthyridine-3-carboxamide |
| SMILES | CNC(=O)c1cn(-c2cccc(C#Cc3cnsn3)c2)c2ncccc2c1=O |
| InChI | InChI=1S/C20H13N5O2S/c1-21-20(27)17-12-25(19-16(18(17)26)6-3-9-22-19)15-5-2-4-13(10-15)7-8-14-11-23-28-24-14/h2-6,9-12H,1H3,(H,21,27) |
| InChIKey | NBGBTQYWPLISHV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|