About 8-(2,4-dichlorophenyl)-4-[(2S)-1-methoxybutan-2-yl]-2-methylpyrido[2,3-b]pyrazin-3-one
8-(2,4-dichlorophenyl)-4-[(2S)-1-methoxybutan-2-yl]-2-methylpyrido[2,3-b]pyrazin-3-one (PubChem CID 10363079) has the molecular formula C19H19Cl2N3O2
and a molecular weight of 392.29 g/mol. Its IUPAC name is 8-(2,4-dichlorophenyl)-4-[(2S)-1-methoxybutan-2-yl]-2-methylpyrido[2,3-b]pyrazin-3-one.
Molecular Properties
| Compound Name | 8-(2,4-dichlorophenyl)-4-[(2S)-1-methoxybutan-2-yl]-2-methylpyrido[2,3-b]pyrazin-3-one |
| PubChem CID | 10363079 |
| Molecular Formula | C19H19Cl2N3O2 |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 8-(2,4-dichlorophenyl)-4-[(2S)-1-methoxybutan-2-yl]-2-methylpyrido[2,3-b]pyrazin-3-one |
| SMILES | CC[C@@H](COC)n1c(=O)c(C)nc2c(-c3ccc(Cl)cc3Cl)ccnc21 |
| InChI | InChI=1S/C19H19Cl2N3O2/c1-4-13(10-26-3)24-18-17(23-11(2)19(24)25)15(7-8-22-18)14-6-5-12(20)9-16(14)21/h5-9,13H,4,10H2,1-3H3/t13-/m0/s1 |
| InChIKey | ZXVYJALWEMWQCF-ZDUSSCGKSA-N |
| XLogP | 4.67 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-(2,4-dichlorophenyl)-4-[(2S)-1-methoxybutan-2-yl]-2-methylpyrido[2,3-b]pyrazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2,4-dichlorophenyl)-4-[(2S)-1-methoxybutan-2-yl]-2-methylpyrido[2,3-b]pyrazin-3-one?
The IUPAC name of 8-(2,4-dichlorophenyl)-4-[(2S)-1-methoxybutan-2-yl]-2-methylpyrido[2,3-b]pyrazin-3-one (CID 10363079) is 8-(2,4-dichlorophenyl)-4-[(2S)-1-methoxybutan-2-yl]-2-methylpyrido[2,3-b]pyrazin-3-one.
What is the SMILES notation for 8-(2,4-dichlorophenyl)-4-[(2S)-1-methoxybutan-2-yl]-2-methylpyrido[2,3-b]pyrazin-3-one?
The canonical SMILES for 8-(2,4-dichlorophenyl)-4-[(2S)-1-methoxybutan-2-yl]-2-methylpyrido[2,3-b]pyrazin-3-one is CC[C@@H](COC)n1c(=O)c(C)nc2c(-c3ccc(Cl)cc3Cl)ccnc21.
What is the InChIKey of 8-(2,4-dichlorophenyl)-4-[(2S)-1-methoxybutan-2-yl]-2-methylpyrido[2,3-b]pyrazin-3-one?
The InChIKey is ZXVYJALWEMWQCF-ZDUSSCGKSA-N. The full InChI is InChI=1S/C19H19Cl2N3O2/c1-4-13(10-26-3)24-18-17(23-11(2)19(24)25)15(7-8-22-18)14-6-5-12(20)9-16(14)21/h5-9,13H,4,10H2,1-3H3/t13-/m0/s1.
What are the key properties of 8-(2,4-dichlorophenyl)-4-[(2S)-1-methoxybutan-2-yl]-2-methylpyrido[2,3-b]pyrazin-3-one?
8-(2,4-dichlorophenyl)-4-[(2S)-1-methoxybutan-2-yl]-2-methylpyrido[2,3-b]pyrazin-3-one has a molecular weight of 392.29 g/mol, XLogP of 4.67, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2,4-dichlorophenyl)-4-[(2S)-1-methoxybutan-2-yl]-2-methylpyrido[2,3-b]pyrazin-3-one is sourced from PubChem (CID 10363079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).