C21H36O5Si — CID 10363375
1-O-ethyl 6-O-methyl (1S,6S,8S)-8-[tert-butyl(dimethyl)silyl]oxy-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1,6-dicarboxylate (PubChem CID 10363375) has the molecular formula C21H36O5Si and a molecular weight of 396.60 g/mol. Its IUPAC name is 1-O-ethyl 6-O-methyl (1S,6S,8S)-8-[tert-butyl(dimethyl)silyl]oxy-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1,6-dicarboxylate.
| Compound Name | 1-O-ethyl 6-O-methyl (1S,6S,8S)-8-[tert-butyl(dimethyl)silyl]oxy-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1,6-dicarboxylate |
|---|---|
| PubChem CID | 10363375 |
| Molecular Formula | C21H36O5Si |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 1-O-ethyl 6-O-methyl (1S,6S,8S)-8-[tert-butyl(dimethyl)silyl]oxy-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1,6-dicarboxylate |
| SMILES | CCOC(=O)C1CC=CC2C[C@H](C(=O)OC)C[C@H](O[Si](C)(C)C(C)(C)C)C21 |
| InChI | InChI=1S/C21H36O5Si/c1-8-25-20(23)16-11-9-10-14-12-15(19(22)24-5)13-17(18(14)16)26-27(6,7)21(2,3)4/h9-10,14-18H,8,11-13H2,1-7H3/t14?,15-,16?,17-,18?/m0/s1 |
| InChIKey | NIDZTVGBHVANQU-ZZEXBNFBSA-N |
| XLogP | 4.33 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|