C24H35NO2Si — CID 10363445
(6S,8aR,12aS,13aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,6,8a,9,10,12a,13,13a-octahydroisoquinolino[2,1-b]isoquinolin-8-one (PubChem CID 10363445) has the molecular formula C24H35NO2Si and a molecular weight of 397.64 g/mol. Its IUPAC name is (6S,8aR,12aS,13aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,6,8a,9,10,12a,13,13a-octahydroisoquinolino[2,1-b]isoquinolin-8-one.
| Compound Name | (6S,8aR,12aS,13aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,6,8a,9,10,12a,13,13a-octahydroisoquinolino[2,1-b]isoquinolin-8-one |
|---|---|
| PubChem CID | 10363445 |
| Molecular Formula | C24H35NO2Si |
| Molecular Weight | 397.64 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | (6S,8aR,12aS,13aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,6,8a,9,10,12a,13,13a-octahydroisoquinolino[2,1-b]isoquinolin-8-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1Cc2ccccc2[C@H]2C[C@H]3C=CCC[C@H]3C(=O)N12 |
| InChI | InChI=1S/C24H35NO2Si/c1-24(2,3)28(4,5)27-16-19-14-17-10-6-8-12-20(17)22-15-18-11-7-9-13-21(18)23(26)25(19)22/h6-8,10-12,18-19,21-22H,9,13-16H2,1-5H3/t18-,19+,21-,22-/m1/s1 |
| InChIKey | HFKCQRGMELUIPQ-NPDDRXJXSA-N |
| XLogP | 5.49 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.64 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|