About 1-diethoxyphosphoryl-1,1-difluoro-3-iodoheptane
1-diethoxyphosphoryl-1,1-difluoro-3-iodoheptane (PubChem CID 10363456) has the molecular formula C11H22F2IO3P
and a molecular weight of 398.17 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-1,1-difluoro-3-iodoheptane.
Molecular Properties
| Compound Name | 1-diethoxyphosphoryl-1,1-difluoro-3-iodoheptane |
| PubChem CID | 10363456 |
| Molecular Formula | C11H22F2IO3P |
| Molecular Weight | 398.17 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | 1-diethoxyphosphoryl-1,1-difluoro-3-iodoheptane |
| SMILES | CCCCC(I)CC(F)(F)P(=O)(OCC)OCC |
| InChI | InChI=1S/C11H22F2IO3P/c1-4-7-8-10(14)9-11(12,13)18(15,16-5-2)17-6-3/h10H,4-9H2,1-3H3 |
| InChIKey | KEJXOCYLJSQVNG-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.17 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-diethoxyphosphoryl-1,1-difluoro-3-iodoheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-diethoxyphosphoryl-1,1-difluoro-3-iodoheptane?
The IUPAC name of 1-diethoxyphosphoryl-1,1-difluoro-3-iodoheptane (CID 10363456) is 1-diethoxyphosphoryl-1,1-difluoro-3-iodoheptane.
What is the SMILES notation for 1-diethoxyphosphoryl-1,1-difluoro-3-iodoheptane?
The canonical SMILES for 1-diethoxyphosphoryl-1,1-difluoro-3-iodoheptane is CCCCC(I)CC(F)(F)P(=O)(OCC)OCC.
What is the InChIKey of 1-diethoxyphosphoryl-1,1-difluoro-3-iodoheptane?
The InChIKey is KEJXOCYLJSQVNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22F2IO3P/c1-4-7-8-10(14)9-11(12,13)18(15,16-5-2)17-6-3/h10H,4-9H2,1-3H3.
What are the key properties of 1-diethoxyphosphoryl-1,1-difluoro-3-iodoheptane?
1-diethoxyphosphoryl-1,1-difluoro-3-iodoheptane has a molecular weight of 398.17 g/mol, XLogP of 5.23, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-diethoxyphosphoryl-1,1-difluoro-3-iodoheptane is sourced from PubChem (CID 10363456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).