C24H30O5 — CID 10363493
2-hydroxy-2-[(2E,6E,9E)-11-hydroxy-3,7,11-trimethyl-8-oxododeca-2,6,9-trienyl]-4-methyl-1-benzofuran-3-one (PubChem CID 10363493) has the molecular formula C24H30O5 and a molecular weight of 398.50 g/mol. Its IUPAC name is 2-hydroxy-2-[(2E,6E,9E)-11-hydroxy-3,7,11-trimethyl-8-oxododeca-2,6,9-trienyl]-4-methyl-1-benzofuran-3-one.
| Compound Name | 2-hydroxy-2-[(2E,6E,9E)-11-hydroxy-3,7,11-trimethyl-8-oxododeca-2,6,9-trienyl]-4-methyl-1-benzofuran-3-one |
|---|---|
| PubChem CID | 10363493 |
| Molecular Formula | C24H30O5 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 2-hydroxy-2-[(2E,6E,9E)-11-hydroxy-3,7,11-trimethyl-8-oxododeca-2,6,9-trienyl]-4-methyl-1-benzofuran-3-one |
| SMILES | C/C(=C\CC1(O)Oc2cccc(C)c2C1=O)CC/C=C(\C)C(=O)/C=C/C(C)(C)O |
| InChI | InChI=1S/C24H30O5/c1-16(8-6-9-17(2)19(25)13-14-23(4,5)27)12-15-24(28)22(26)21-18(3)10-7-11-20(21)29-24/h7,9-14,27-28H,6,8,15H2,1-5H3/b14-13+,16-12+,17-9+ |
| InChIKey | GVTHSGZHUOJHBB-GCCVESNXSA-N |
| XLogP | 4.22 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|