C22H40O6 — CID 10363632
methyl 2-[(2S)-1-(methoxymethoxy)-2-(oxan-2-yloxy)propyl]undec-10-enoate (PubChem CID 10363632) has the molecular formula C22H40O6 and a molecular weight of 400.56 g/mol. Its IUPAC name is methyl 2-[(2S)-1-(methoxymethoxy)-2-(oxan-2-yloxy)propyl]undec-10-enoate.
| Compound Name | methyl 2-[(2S)-1-(methoxymethoxy)-2-(oxan-2-yloxy)propyl]undec-10-enoate |
|---|---|
| PubChem CID | 10363632 |
| Molecular Formula | C22H40O6 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | methyl 2-[(2S)-1-(methoxymethoxy)-2-(oxan-2-yloxy)propyl]undec-10-enoate |
| SMILES | C=CCCCCCCCC(C(=O)OC)C(OCOC)[C@H](C)OC1CCCCO1 |
| InChI | InChI=1S/C22H40O6/c1-5-6-7-8-9-10-11-14-19(22(23)25-4)21(27-17-24-3)18(2)28-20-15-12-13-16-26-20/h5,18-21H,1,6-17H2,2-4H3/t18-,19?,20?,21?/m0/s1 |
| InChIKey | DYJBLOWMTYXTSV-PCMKAUBLSA-N |
| XLogP | 4.61 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|