C12H19BrN2S — CID 103637840
N-[(5-bromothiophen-2-yl)methyl]-N'-cyclopropyl-N'-ethylethane-1,2-diamine (PubChem CID 103637840) has the molecular formula C12H19BrN2S and a molecular weight of 303.27 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-N'-cyclopropyl-N'-ethylethane-1,2-diamine.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-N'-cyclopropyl-N'-ethylethane-1,2-diamine |
|---|---|
| PubChem CID | 103637840 |
| Molecular Formula | C12H19BrN2S |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-N'-cyclopropyl-N'-ethylethane-1,2-diamine |
| SMILES | CCN(CCNCc1ccc(Br)s1)C1CC1 |
| InChI | InChI=1S/C12H19BrN2S/c1-2-15(10-3-4-10)8-7-14-9-11-5-6-12(13)16-11/h5-6,10,14H,2-4,7-9H2,1H3 |
| InChIKey | VJJNFZZJDQYFRY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|