About 6-(4-benzylpiperazin-1-yl)-8-chloro-11H-pyrido[2,3-b][1,4]benzodiazepine
6-(4-benzylpiperazin-1-yl)-8-chloro-11H-pyrido[2,3-b][1,4]benzodiazepine (PubChem CID 10363821) has the molecular formula C23H22ClN5
and a molecular weight of 403.92 g/mol. Its IUPAC name is 6-(4-benzylpiperazin-1-yl)-8-chloro-11H-pyrido[2,3-b][1,4]benzodiazepine.
Molecular Properties
| Compound Name | 6-(4-benzylpiperazin-1-yl)-8-chloro-11H-pyrido[2,3-b][1,4]benzodiazepine |
| PubChem CID | 10363821 |
| Molecular Formula | C23H22ClN5 |
| Molecular Weight | 403.92 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 6-(4-benzylpiperazin-1-yl)-8-chloro-11H-pyrido[2,3-b][1,4]benzodiazepine |
| SMILES | Clc1ccc2c(c1)C(N1CCN(Cc3ccccc3)CC1)=Nc1cccnc1N2 |
| InChI | InChI=1S/C23H22ClN5/c24-18-8-9-20-19(15-18)23(27-21-7-4-10-25-22(21)26-20)29-13-11-28(12-14-29)16-17-5-2-1-3-6-17/h1-10,15H,11-14,16H2,(H,25,26) |
| InChIKey | MVUVSHXUPTVDBC-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 43.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.92 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(4-benzylpiperazin-1-yl)-8-chloro-11H-pyrido[2,3-b][1,4]benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-benzylpiperazin-1-yl)-8-chloro-11H-pyrido[2,3-b][1,4]benzodiazepine?
The IUPAC name of 6-(4-benzylpiperazin-1-yl)-8-chloro-11H-pyrido[2,3-b][1,4]benzodiazepine (CID 10363821) is 6-(4-benzylpiperazin-1-yl)-8-chloro-11H-pyrido[2,3-b][1,4]benzodiazepine.
What is the SMILES notation for 6-(4-benzylpiperazin-1-yl)-8-chloro-11H-pyrido[2,3-b][1,4]benzodiazepine?
The canonical SMILES for 6-(4-benzylpiperazin-1-yl)-8-chloro-11H-pyrido[2,3-b][1,4]benzodiazepine is Clc1ccc2c(c1)C(N1CCN(Cc3ccccc3)CC1)=Nc1cccnc1N2.
What is the InChIKey of 6-(4-benzylpiperazin-1-yl)-8-chloro-11H-pyrido[2,3-b][1,4]benzodiazepine?
The InChIKey is MVUVSHXUPTVDBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22ClN5/c24-18-8-9-20-19(15-18)23(27-21-7-4-10-25-22(21)26-20)29-13-11-28(12-14-29)16-17-5-2-1-3-6-17/h1-10,15H,11-14,16H2,(H,25,26).
What are the key properties of 6-(4-benzylpiperazin-1-yl)-8-chloro-11H-pyrido[2,3-b][1,4]benzodiazepine?
6-(4-benzylpiperazin-1-yl)-8-chloro-11H-pyrido[2,3-b][1,4]benzodiazepine has a molecular weight of 403.92 g/mol, XLogP of 4.69, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-benzylpiperazin-1-yl)-8-chloro-11H-pyrido[2,3-b][1,4]benzodiazepine is sourced from PubChem (CID 10363821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).