About 2,7-ditert-butyl-1,8-dinitropyrene
2,7-ditert-butyl-1,8-dinitropyrene (PubChem CID 10363854) has the molecular formula C24H24N2O4
and a molecular weight of 404.47 g/mol. Its IUPAC name is 2,7-ditert-butyl-1,8-dinitropyrene.
Molecular Properties
| Compound Name | 2,7-ditert-butyl-1,8-dinitropyrene |
| PubChem CID | 10363854 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 2,7-ditert-butyl-1,8-dinitropyrene |
| SMILES | CC(C)(C)c1cc2ccc3cc(C(C)(C)C)c([N+](=O)[O-])c4ccc(c1[N+](=O)[O-])c2c34 |
| InChI | InChI=1S/C24H24N2O4/c1-23(2,3)17-11-13-7-8-14-12-18(24(4,5)6)22(26(29)30)16-10-9-15(19(13)20(14)16)21(17)25(27)28/h7-12H,1-6H3 |
| InChIKey | UZWIIJBOJDRJLF-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2,7-ditert-butyl-1,8-dinitropyrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-ditert-butyl-1,8-dinitropyrene?
The IUPAC name of 2,7-ditert-butyl-1,8-dinitropyrene (CID 10363854) is 2,7-ditert-butyl-1,8-dinitropyrene.
What is the SMILES notation for 2,7-ditert-butyl-1,8-dinitropyrene?
The canonical SMILES for 2,7-ditert-butyl-1,8-dinitropyrene is CC(C)(C)c1cc2ccc3cc(C(C)(C)C)c([N+](=O)[O-])c4ccc(c1[N+](=O)[O-])c2c34.
What is the InChIKey of 2,7-ditert-butyl-1,8-dinitropyrene?
The InChIKey is UZWIIJBOJDRJLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24N2O4/c1-23(2,3)17-11-13-7-8-14-12-18(24(4,5)6)22(26(29)30)16-10-9-15(19(13)20(14)16)21(17)25(27)28/h7-12H,1-6H3.
What are the key properties of 2,7-ditert-butyl-1,8-dinitropyrene?
2,7-ditert-butyl-1,8-dinitropyrene has a molecular weight of 404.47 g/mol, XLogP of 7.00, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-ditert-butyl-1,8-dinitropyrene is sourced from PubChem (CID 10363854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).