C25H40O4 — CID 10363875
2-[(2R,5S)-5-[(4E,8E,12E)-14-hydroxy-4,8,12-trimethyltetradeca-4,8,12-trienyl]oxan-2-yl]prop-2-enoic acid (PubChem CID 10363875) has the molecular formula C25H40O4 and a molecular weight of 404.59 g/mol. Its IUPAC name is 2-[(2R,5S)-5-[(4E,8E,12E)-14-hydroxy-4,8,12-trimethyltetradeca-4,8,12-trienyl]oxan-2-yl]prop-2-enoic acid.
| Compound Name | 2-[(2R,5S)-5-[(4E,8E,12E)-14-hydroxy-4,8,12-trimethyltetradeca-4,8,12-trienyl]oxan-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 10363875 |
| Molecular Formula | C25H40O4 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | 2-[(2R,5S)-5-[(4E,8E,12E)-14-hydroxy-4,8,12-trimethyltetradeca-4,8,12-trienyl]oxan-2-yl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)[C@H]1CC[C@H](CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CO)CO1 |
| InChI | InChI=1S/C25H40O4/c1-19(10-6-11-21(3)16-17-26)8-5-9-20(2)12-7-13-23-14-15-24(29-18-23)22(4)25(27)28/h9-10,16,23-24,26H,4-8,11-15,17-18H2,1-3H3,(H,27,28)/b19-10+,20-9+,21-16+/t23-,24+/m0/s1 |
| InChIKey | DDMJOFRBTNPRLF-PFIHGRDSSA-N |
| XLogP | 5.98 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|