About 2-[(2,6-dichlorophenyl)methyl]-N-[4-(dimethylamino)phenyl]-1,3-thiazole-4-carboxamide
2-[(2,6-dichlorophenyl)methyl]-N-[4-(dimethylamino)phenyl]-1,3-thiazole-4-carboxamide (PubChem CID 10363943) has the molecular formula C19H17Cl2N3OS
and a molecular weight of 406.34 g/mol. Its IUPAC name is 2-[(2,6-dichlorophenyl)methyl]-N-[4-(dimethylamino)phenyl]-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-[(2,6-dichlorophenyl)methyl]-N-[4-(dimethylamino)phenyl]-1,3-thiazole-4-carboxamide |
| PubChem CID | 10363943 |
| Molecular Formula | C19H17Cl2N3OS |
| Molecular Weight | 406.34 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | 2-[(2,6-dichlorophenyl)methyl]-N-[4-(dimethylamino)phenyl]-1,3-thiazole-4-carboxamide |
| SMILES | CN(C)c1ccc(NC(=O)c2csc(Cc3c(Cl)cccc3Cl)n2)cc1 |
| InChI | InChI=1S/C19H17Cl2N3OS/c1-24(2)13-8-6-12(7-9-13)22-19(25)17-11-26-18(23-17)10-14-15(20)4-3-5-16(14)21/h3-9,11H,10H2,1-2H3,(H,22,25) |
| InChIKey | AXFJAOYHLOYOJS-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.34 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2,6-dichlorophenyl)methyl]-N-[4-(dimethylamino)phenyl]-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,6-dichlorophenyl)methyl]-N-[4-(dimethylamino)phenyl]-1,3-thiazole-4-carboxamide?
The IUPAC name of 2-[(2,6-dichlorophenyl)methyl]-N-[4-(dimethylamino)phenyl]-1,3-thiazole-4-carboxamide (CID 10363943) is 2-[(2,6-dichlorophenyl)methyl]-N-[4-(dimethylamino)phenyl]-1,3-thiazole-4-carboxamide.
What is the SMILES notation for 2-[(2,6-dichlorophenyl)methyl]-N-[4-(dimethylamino)phenyl]-1,3-thiazole-4-carboxamide?
The canonical SMILES for 2-[(2,6-dichlorophenyl)methyl]-N-[4-(dimethylamino)phenyl]-1,3-thiazole-4-carboxamide is CN(C)c1ccc(NC(=O)c2csc(Cc3c(Cl)cccc3Cl)n2)cc1.
What is the InChIKey of 2-[(2,6-dichlorophenyl)methyl]-N-[4-(dimethylamino)phenyl]-1,3-thiazole-4-carboxamide?
The InChIKey is AXFJAOYHLOYOJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17Cl2N3OS/c1-24(2)13-8-6-12(7-9-13)22-19(25)17-11-26-18(23-17)10-14-15(20)4-3-5-16(14)21/h3-9,11H,10H2,1-2H3,(H,22,25).
What are the key properties of 2-[(2,6-dichlorophenyl)methyl]-N-[4-(dimethylamino)phenyl]-1,3-thiazole-4-carboxamide?
2-[(2,6-dichlorophenyl)methyl]-N-[4-(dimethylamino)phenyl]-1,3-thiazole-4-carboxamide has a molecular weight of 406.34 g/mol, XLogP of 5.36, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,6-dichlorophenyl)methyl]-N-[4-(dimethylamino)phenyl]-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 10363943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).