C22H30O5S — CID 10363990
[(1S,3aR,4S,6S,8aR)-1-(2-methoxyethoxymethoxy)-6-phenylsulfanyl-1,2,3,3a,4,5,6,8a-octahydroazulen-4-yl] acetate (PubChem CID 10363990) has the molecular formula C22H30O5S and a molecular weight of 406.54 g/mol. Its IUPAC name is [(1S,3aR,4S,6S,8aR)-1-(2-methoxyethoxymethoxy)-6-phenylsulfanyl-1,2,3,3a,4,5,6,8a-octahydroazulen-4-yl] acetate.
| Compound Name | [(1S,3aR,4S,6S,8aR)-1-(2-methoxyethoxymethoxy)-6-phenylsulfanyl-1,2,3,3a,4,5,6,8a-octahydroazulen-4-yl] acetate |
|---|---|
| PubChem CID | 10363990 |
| Molecular Formula | C22H30O5S |
| Molecular Weight | 406.54 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | [(1S,3aR,4S,6S,8aR)-1-(2-methoxyethoxymethoxy)-6-phenylsulfanyl-1,2,3,3a,4,5,6,8a-octahydroazulen-4-yl] acetate |
| SMILES | COCCOCO[C@H]1CC[C@@H]2[C@H]1C=C[C@@H](Sc1ccccc1)C[C@@H]2OC(C)=O |
| InChI | InChI=1S/C22H30O5S/c1-16(23)27-22-14-18(28-17-6-4-3-5-7-17)8-9-19-20(22)10-11-21(19)26-15-25-13-12-24-2/h3-9,18-22H,10-15H2,1-2H3/t18-,19-,20-,21+,22+/m1/s1 |
| InChIKey | XRCLRBWWMOKKCU-YXIAPDDASA-N |
| XLogP | 4.07 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.54 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|