C23H22F2N4O — CID 10364093
5-[(4S,5S)-5-(4-fluorophenyl)-5-(6-fluoro-3-pyridinyl)-4-methyl-1,4-dihydroimidazol-2-yl]-1-propylpyridin-2-one (PubChem CID 10364093) has the molecular formula C23H22F2N4O and a molecular weight of 408.45 g/mol. Its IUPAC name is 5-[(4S,5S)-5-(4-fluorophenyl)-5-(6-fluoro-3-pyridinyl)-4-methyl-1,4-dihydroimidazol-2-yl]-1-propylpyridin-2-one.
| Compound Name | 5-[(4S,5S)-5-(4-fluorophenyl)-5-(6-fluoro-3-pyridinyl)-4-methyl-1,4-dihydroimidazol-2-yl]-1-propylpyridin-2-one |
|---|---|
| PubChem CID | 10364093 |
| Molecular Formula | C23H22F2N4O |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 5-[(4S,5S)-5-(4-fluorophenyl)-5-(6-fluoro-3-pyridinyl)-4-methyl-1,4-dihydroimidazol-2-yl]-1-propylpyridin-2-one |
| SMILES | CCCn1cc(C2=N[C@@H](C)[C@](c3ccc(F)cc3)(c3ccc(F)nc3)N2)ccc1=O |
| InChI | InChI=1S/C23H22F2N4O/c1-3-12-29-14-16(4-11-21(29)30)22-27-15(2)23(28-22,17-5-8-19(24)9-6-17)18-7-10-20(25)26-13-18/h4-11,13-15H,3,12H2,1-2H3,(H,27,28)/t15-,23-/m0/s1 |
| InChIKey | LSLQFUYTMXHXKN-WNSKOXEYSA-N |
| XLogP | 3.61 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|