C24H19N5O2 — CID 10364151
3-[1-(3-phenylpropyl)pyrrolo[2,3-b]pyridin-3-yl]-4-pyrimidin-5-ylpyrrole-2,5-dione (PubChem CID 10364151) has the molecular formula C24H19N5O2 and a molecular weight of 409.45 g/mol. Its IUPAC name is 3-[1-(3-phenylpropyl)pyrrolo[2,3-b]pyridin-3-yl]-4-pyrimidin-5-ylpyrrole-2,5-dione.
| Compound Name | 3-[1-(3-phenylpropyl)pyrrolo[2,3-b]pyridin-3-yl]-4-pyrimidin-5-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 10364151 |
| Molecular Formula | C24H19N5O2 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 3-[1-(3-phenylpropyl)pyrrolo[2,3-b]pyridin-3-yl]-4-pyrimidin-5-ylpyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2cn(CCCc3ccccc3)c3ncccc23)=C1c1cncnc1 |
| InChI | InChI=1S/C24H19N5O2/c30-23-20(17-12-25-15-26-13-17)21(24(31)28-23)19-14-29(22-18(19)9-4-10-27-22)11-5-8-16-6-2-1-3-7-16/h1-4,6-7,9-10,12-15H,5,8,11H2,(H,28,30,31) |
| InChIKey | KCQZHTYYOVRAPA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|