About 6-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyloctan-3-one
6-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyloctan-3-one (PubChem CID 10364271) has the molecular formula C26H38O2Si
and a molecular weight of 410.67 g/mol. Its IUPAC name is 6-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyloctan-3-one.
Molecular Properties
| Compound Name | 6-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyloctan-3-one |
| PubChem CID | 10364271 |
| Molecular Formula | C26H38O2Si |
| Molecular Weight | 410.67 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | 6-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyloctan-3-one |
| SMILES | CCC(CCC(=O)C(C)(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H38O2Si/c1-8-21(19-20-24(27)25(2,3)4)28-29(26(5,6)7,22-15-11-9-12-16-22)23-17-13-10-14-18-23/h9-18,21H,8,19-20H2,1-7H3 |
| InChIKey | VNGWQNXAHAVAMX-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.67 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 6-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyloctan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyloctan-3-one?
The IUPAC name of 6-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyloctan-3-one (CID 10364271) is 6-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyloctan-3-one.
What is the SMILES notation for 6-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyloctan-3-one?
The canonical SMILES for 6-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyloctan-3-one is CCC(CCC(=O)C(C)(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C.
What is the InChIKey of 6-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyloctan-3-one?
The InChIKey is VNGWQNXAHAVAMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H38O2Si/c1-8-21(19-20-24(27)25(2,3)4)28-29(26(5,6)7,22-15-11-9-12-16-22)23-17-13-10-14-18-23/h9-18,21H,8,19-20H2,1-7H3.
What are the key properties of 6-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyloctan-3-one?
6-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyloctan-3-one has a molecular weight of 410.67 g/mol, XLogP of 5.74, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyloctan-3-one is sourced from PubChem (CID 10364271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).