C21H27F2NO3S — CID 10364316
7-[(2R)-2-[(E,3S)-4-(3,4-difluorophenyl)-3-hydroxybut-1-enyl]-5-sulfanylidenepyrrolidin-1-yl]heptanoic acid (PubChem CID 10364316) has the molecular formula C21H27F2NO3S and a molecular weight of 411.51 g/mol. Its IUPAC name is 7-[(2R)-2-[(E,3S)-4-(3,4-difluorophenyl)-3-hydroxybut-1-enyl]-5-sulfanylidenepyrrolidin-1-yl]heptanoic acid.
| Compound Name | 7-[(2R)-2-[(E,3S)-4-(3,4-difluorophenyl)-3-hydroxybut-1-enyl]-5-sulfanylidenepyrrolidin-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 10364316 |
| Molecular Formula | C21H27F2NO3S |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 7-[(2R)-2-[(E,3S)-4-(3,4-difluorophenyl)-3-hydroxybut-1-enyl]-5-sulfanylidenepyrrolidin-1-yl]heptanoic acid |
| SMILES | O=C(O)CCCCCCN1C(=S)CC[C@@H]1/C=C/[C@@H](O)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C21H27F2NO3S/c22-18-10-6-15(14-19(18)23)13-17(25)9-7-16-8-11-20(28)24(16)12-4-2-1-3-5-21(26)27/h6-7,9-10,14,16-17,25H,1-5,8,11-13H2,(H,26,27)/b9-7+/t16-,17+/m0/s1 |
| InChIKey | CSQBEZNGMHQSEN-OLMWUWOUSA-N |
| XLogP | 4.25 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|