C13H14F3N3O — CID 103643790
2-imidazol-1-yl-N-[[3-(trifluoromethoxy)phenyl]methyl]ethanamine (PubChem CID 103643790) has the molecular formula C13H14F3N3O and a molecular weight of 285.27 g/mol. Its IUPAC name is 2-imidazol-1-yl-N-[[3-(trifluoromethoxy)phenyl]methyl]ethanamine.
| Compound Name | 2-imidazol-1-yl-N-[[3-(trifluoromethoxy)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 103643790 |
| Molecular Formula | C13H14F3N3O |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 2-imidazol-1-yl-N-[[3-(trifluoromethoxy)phenyl]methyl]ethanamine |
| SMILES | FC(F)(F)Oc1cccc(CNCCn2ccnc2)c1 |
| InChI | InChI=1S/C13H14F3N3O/c14-13(15,16)20-12-3-1-2-11(8-12)9-17-4-6-19-7-5-18-10-19/h1-3,5,7-8,10,17H,4,6,9H2 |
| InChIKey | ZWTSUFHMZORRIM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|