C11H14FN5 — CID 103644661
5-fluoro-6-methyl-N-[2-(1-methylimidazol-2-yl)ethyl]pyrimidin-4-amine (PubChem CID 103644661) has the molecular formula C11H14FN5 and a molecular weight of 235.27 g/mol. Its IUPAC name is 5-fluoro-6-methyl-N-[2-(1-methylimidazol-2-yl)ethyl]pyrimidin-4-amine.
| Compound Name | 5-fluoro-6-methyl-N-[2-(1-methylimidazol-2-yl)ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 103644661 |
| Molecular Formula | C11H14FN5 |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 5-fluoro-6-methyl-N-[2-(1-methylimidazol-2-yl)ethyl]pyrimidin-4-amine |
| SMILES | Cc1ncnc(NCCc2nccn2C)c1F |
| InChI | InChI=1S/C11H14FN5/c1-8-10(12)11(16-7-15-8)14-4-3-9-13-5-6-17(9)2/h5-7H,3-4H2,1-2H3,(H,14,15,16) |
| InChIKey | URYBZAKKEMKNNH-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |