C24H33NO3S — CID 10364551
(1S,2S,3S,4R)-3,7,7-trimethyl-1-(spiro[indene-1,4'-piperidine]-1'-ylsulfonylmethyl)bicyclo[2.2.1]heptan-2-ol (PubChem CID 10364551) has the molecular formula C24H33NO3S and a molecular weight of 415.60 g/mol. Its IUPAC name is (1S,2S,3S,4R)-3,7,7-trimethyl-1-(spiro[indene-1,4'-piperidine]-1'-ylsulfonylmethyl)bicyclo[2.2.1]heptan-2-ol.
| Compound Name | (1S,2S,3S,4R)-3,7,7-trimethyl-1-(spiro[indene-1,4'-piperidine]-1'-ylsulfonylmethyl)bicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 10364551 |
| Molecular Formula | C24H33NO3S |
| Molecular Weight | 415.60 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | (1S,2S,3S,4R)-3,7,7-trimethyl-1-(spiro[indene-1,4'-piperidine]-1'-ylsulfonylmethyl)bicyclo[2.2.1]heptan-2-ol |
| SMILES | C[C@H]1[C@H]2CC[C@@](CS(=O)(=O)N3CCC4(C=Cc5ccccc54)CC3)([C@H]1O)C2(C)C |
| InChI | InChI=1S/C24H33NO3S/c1-17-19-9-11-24(21(17)26,22(19,2)3)16-29(27,28)25-14-12-23(13-15-25)10-8-18-6-4-5-7-20(18)23/h4-8,10,17,19,21,26H,9,11-16H2,1-3H3/t17-,19+,21-,24+/m0/s1 |
| InChIKey | WDCPKDGQHJWMLP-VCWCOCMLSA-N |
| XLogP | 3.81 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.60 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |