C21H21F6NO — CID 10364638
3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-3-phenylpiperidine (PubChem CID 10364638) has the molecular formula C21H21F6NO and a molecular weight of 417.39 g/mol. Its IUPAC name is 3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-3-phenylpiperidine.
| Compound Name | 3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-3-phenylpiperidine |
|---|---|
| PubChem CID | 10364638 |
| Molecular Formula | C21H21F6NO |
| Molecular Weight | 417.39 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 3-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-3-phenylpiperidine |
| SMILES | FC(F)(F)c1cc(COCC2(c3ccccc3)CCCNC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H21F6NO/c22-20(23,24)17-9-15(10-18(11-17)21(25,26)27)12-29-14-19(7-4-8-28-13-19)16-5-2-1-3-6-16/h1-3,5-6,9-11,28H,4,7-8,12-14H2 |
| InChIKey | JCQSGNUMUCYWTO-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.39 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |