C25H27N3O3 — CID 10364662
N-[15-[2-(dimethylamino)ethyl]-14,16-dioxo-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,8,10,12-heptaen-4-yl]-2,2-dimethylpropanamide (PubChem CID 10364662) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is N-[15-[2-(dimethylamino)ethyl]-14,16-dioxo-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,8,10,12-heptaen-4-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[15-[2-(dimethylamino)ethyl]-14,16-dioxo-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,8,10,12-heptaen-4-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 10364662 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | N-[15-[2-(dimethylamino)ethyl]-14,16-dioxo-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,8,10,12-heptaen-4-yl]-2,2-dimethylpropanamide |
| SMILES | CN(C)CCN1C(=O)c2cccc3cc4ccc(NC(=O)C(C)(C)C)cc4c(c23)C1=O |
| InChI | InChI=1S/C25H27N3O3/c1-25(2,3)24(31)26-17-10-9-15-13-16-7-6-8-18-20(16)21(19(15)14-17)23(30)28(22(18)29)12-11-27(4)5/h6-10,13-14H,11-12H2,1-5H3,(H,26,31) |
| InChIKey | DDPVQBZDHSMXPC-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|