C22H27FN2O5 — CID 10364703
tert-butyl 5-fluoro-4-oxo-3-[[(2S)-2-(1-oxoisoquinolin-2-yl)butanoyl]amino]pentanoate (PubChem CID 10364703) has the molecular formula C22H27FN2O5 and a molecular weight of 418.47 g/mol. Its IUPAC name is tert-butyl 5-fluoro-4-oxo-3-[[(2S)-2-(1-oxoisoquinolin-2-yl)butanoyl]amino]pentanoate.
| Compound Name | tert-butyl 5-fluoro-4-oxo-3-[[(2S)-2-(1-oxoisoquinolin-2-yl)butanoyl]amino]pentanoate |
|---|---|
| PubChem CID | 10364703 |
| Molecular Formula | C22H27FN2O5 |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | tert-butyl 5-fluoro-4-oxo-3-[[(2S)-2-(1-oxoisoquinolin-2-yl)butanoyl]amino]pentanoate |
| SMILES | CC[C@@H](C(=O)NC(CC(=O)OC(C)(C)C)C(=O)CF)n1ccc2ccccc2c1=O |
| InChI | InChI=1S/C22H27FN2O5/c1-5-17(25-11-10-14-8-6-7-9-15(14)21(25)29)20(28)24-16(18(26)13-23)12-19(27)30-22(2,3)4/h6-11,16-17H,5,12-13H2,1-4H3,(H,24,28)/t16?,17-/m0/s1 |
| InChIKey | MJHRYAZORBGXEM-DJNXLDHESA-N |
| XLogP | 2.71 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |