C10H17N3S — CID 103647744
N-[(1-methylpyrazol-4-yl)methyl]-2-prop-2-enylsulfanylethanamine (PubChem CID 103647744) has the molecular formula C10H17N3S and a molecular weight of 211.33 g/mol. Its IUPAC name is N-[(1-methylpyrazol-4-yl)methyl]-2-prop-2-enylsulfanylethanamine.
| Compound Name | N-[(1-methylpyrazol-4-yl)methyl]-2-prop-2-enylsulfanylethanamine |
|---|---|
| PubChem CID | 103647744 |
| Molecular Formula | C10H17N3S |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | N-[(1-methylpyrazol-4-yl)methyl]-2-prop-2-enylsulfanylethanamine |
| SMILES | C=CCSCCNCc1cnn(C)c1 |
| InChI | InChI=1S/C10H17N3S/c1-3-5-14-6-4-11-7-10-8-12-13(2)9-10/h3,8-9,11H,1,4-7H2,2H3 |
| InChIKey | GYFSRRKFVGDTDK-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|